#!/usr/bin/env python # coding: utf-8 # ## Initial imports import pyCRS import matplotlib.pyplot as plt import math import scm.plams as plams # ## Property prediction from SMILES (ethyl acetate) from scm.plams import from_smiles # smiles = 'CCO' # ethanol smiles = "O=C(OCC)C" # ethyl acetate plams.view(plams.from_smiles(smiles), width=300, height=300) # ### Temperature-independent properties print(f"SMILES: {smiles}\n") mol = pyCRS.Input.read_smiles(smiles) temperatures = [298.15, 308.15, 318.15, 328.15, 338.15] pyCRS.PropPred.estimate(mol, temperatures=temperatures) for prop, value in mol.properties.items(): unit = pyCRS.PropPred.units[prop] print(f"{prop:<20s}: {value:.3f} {unit}") # ### Temperature-dependent properties (vapor pressure) prop = "vaporpressure" unit = pyCRS.PropPred.units[prop] temperatures_K, vaporpressures = mol.get_tdep_values(prop) temperatures_C = [t - 273.15 for t in temperatures_K] # convert to Celsius plt.figure(figsize=(3, 3)) plt.plot(temperatures_C, vaporpressures) plt.plot(temperatures_C, vaporpressures, ".") plt.xlabel("Temperature (degree Celsius)") plt.title(f"SMILES: {smiles}") plt.ylabel(f"{prop} [{unit}]") plt.gcf().savefig("picture1.png") plt.clf() # ## Create .csv for multiple compounds # # Define a list of compounds by their SMILES strings. This example also shows how to only calculate a subset of all properties. # # Note: The SMILES string 'C' corresponds to methane which is too small to be used with the property prediction tool, so the results are given as 'nan' (not a number). smiles_list = [ "CCO", "CCOC", "OCCCN", "C", # methane is too small to be used with property prediction and will return "nan" "C1=CC=C(C=C1)COCC2=CC=CC=C2", ] temperatures = list(range(280, 340, 10)) mols = [pyCRS.Input.read_smiles(s) for s in smiles_list] properties = ["boilingpoint", "criticaltemp", "hformstd"] for mol in mols: pyCRS.PropPred.estimate(mol, properties, temperatures=temperatures) def get_csv(mols, properties): header = "SMILES" for prop in properties: unit = pyCRS.PropPred.units[prop] if unit: unit = f" [{unit}]" else: unit = "" header += f",{prop}{unit}" ret = header + "\n" for mol in mols: s = f"{mol.smiles}" for prop in properties: value = mol.properties.get(prop, "") try: s += f",{value:.4f}" except TypeError: s += f",{value}" s += "\n" ret += s return ret csv = get_csv(mols, properties) print(csv) # To write to a .csv file: # with open('outputfile.csv', 'w') as f: # f.write(csv) # ### Bar chart for multiple compounds # # Continuing from the previous example, you can also create e.g. a bar chart with the boiling points: prop = "boilingpoint" values = [mol.properties.get(prop, None) for mol in mols] filtered = [(s, v) for s, v in zip(smiles_list, values) if not math.isnan(v)] smiles_plot, values_plot = zip(*filtered) plt.barh(smiles_plot, values_plot) plt.title("Boiling point [K]") plt.gcf().savefig("picture2.png") plt.clf()